C28H28ClNO5S — CID 22459008
5-[3-[3-[4-(4-chloro-3-methylphenoxy)-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione (PubChem CID 22459008) has the molecular formula C28H28ClNO5S and a molecular weight of 526.05 g/mol. Its IUPAC name is 5-[3-[3-[4-(4-chloro-3-methylphenoxy)-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[3-[3-[4-(4-chloro-3-methylphenoxy)-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 22459008 |
| Molecular Formula | C28H28ClNO5S |
| Molecular Weight | 526.05 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 5-[3-[3-[4-(4-chloro-3-methylphenoxy)-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCc1cc(Oc2ccc(Cl)c(C)c2)ccc1OCCCOc1cccc(C2SC(=O)NC2=O)c1 |
| InChI | InChI=1S/C28H28ClNO5S/c1-3-6-19-16-23(35-22-9-11-24(29)18(2)15-22)10-12-25(19)34-14-5-13-33-21-8-4-7-20(17-21)26-27(31)30-28(32)36-26/h4,7-12,15-17,26H,3,5-6,13-14H2,1-2H3,(H,30,31,32) |
| InChIKey | RHXBMPROSWDTQC-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.05 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|