C28H25FN2O5S — CID 22459030
5-[4-[3-[4-(1,2-benzoxazol-3-yl)-2-propylphenoxy]propoxy]phenyl]-5-fluoro-1,3-thiazolidine-2,4-dione (PubChem CID 22459030) has the molecular formula C28H25FN2O5S and a molecular weight of 520.58 g/mol. Its IUPAC name is 5-[4-[3-[4-(1,2-benzoxazol-3-yl)-2-propylphenoxy]propoxy]phenyl]-5-fluoro-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[4-[3-[4-(1,2-benzoxazol-3-yl)-2-propylphenoxy]propoxy]phenyl]-5-fluoro-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 22459030 |
| Molecular Formula | C28H25FN2O5S |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 5-[4-[3-[4-(1,2-benzoxazol-3-yl)-2-propylphenoxy]propoxy]phenyl]-5-fluoro-1,3-thiazolidine-2,4-dione |
| SMILES | CCCc1cc(-c2noc3ccccc23)ccc1OCCCOc1ccc(C2(F)SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C28H25FN2O5S/c1-2-6-18-17-19(25-22-7-3-4-8-24(22)36-31-25)9-14-23(18)35-16-5-15-34-21-12-10-20(11-13-21)28(29)26(32)30-27(33)37-28/h3-4,7-14,17H,2,5-6,15-16H2,1H3,(H,30,32,33) |
| InChIKey | CDOAGIPVRKHOTE-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|