C27H25ClFNO5S — CID 22459122
4-[3-chloro-4-[3-(4-phenoxy-2-propylphenoxy)propoxy]phenyl]-4-fluoro-1,3-thiazolidine-2,5-dione (PubChem CID 22459122) has the molecular formula C27H25ClFNO5S and a molecular weight of 530.02 g/mol. Its IUPAC name is 4-[3-chloro-4-[3-(4-phenoxy-2-propylphenoxy)propoxy]phenyl]-4-fluoro-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[3-chloro-4-[3-(4-phenoxy-2-propylphenoxy)propoxy]phenyl]-4-fluoro-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 22459122 |
| Molecular Formula | C27H25ClFNO5S |
| Molecular Weight | 530.02 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 4-[3-chloro-4-[3-(4-phenoxy-2-propylphenoxy)propoxy]phenyl]-4-fluoro-1,3-thiazolidine-2,5-dione |
| SMILES | CCCc1cc(Oc2ccccc2)ccc1OCCCOc1ccc(C2(F)NC(=O)SC2=O)cc1Cl |
| InChI | InChI=1S/C27H25ClFNO5S/c1-2-7-18-16-21(35-20-8-4-3-5-9-20)11-13-23(18)33-14-6-15-34-24-12-10-19(17-22(24)28)27(29)25(31)36-26(32)30-27/h3-5,8-13,16-17H,2,6-7,14-15H2,1H3,(H,30,32) |
| InChIKey | AXZBBTZTZVSQRS-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.02 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|