C15H29NSi — CID 22459480
N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]-N-ethylethanamine (PubChem CID 22459480) has the molecular formula C15H29NSi and a molecular weight of 251.49 g/mol. Its IUPAC name is N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]-N-ethylethanamine.
| Compound Name | N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 22459480 |
| Molecular Formula | C15H29NSi |
| Molecular Weight | 251.49 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]-N-ethylethanamine |
| SMILES | CCN(CC)[Si](C)(C)C1=C(C)C(C)=C(C)C1C |
| InChI | InChI=1S/C15H29NSi/c1-9-16(10-2)17(7,8)15-13(5)11(3)12(4)14(15)6/h13H,9-10H2,1-8H3 |
| InChIKey | MFIMHDBHTNZOLJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|