About triethoxy(4,4,4-trifluorobutyl)silane
triethoxy(4,4,4-trifluorobutyl)silane (PubChem CID 22459507) has the molecular formula C10H21F3O3Si
and a molecular weight of 274.35 g/mol. Its IUPAC name is triethoxy(4,4,4-trifluorobutyl)silane.
Molecular Properties
| Compound Name | triethoxy(4,4,4-trifluorobutyl)silane |
| PubChem CID | 22459507 |
| Molecular Formula | C10H21F3O3Si |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | triethoxy(4,4,4-trifluorobutyl)silane |
| SMILES | CCO[Si](CCCC(F)(F)F)(OCC)OCC |
| InChI | InChI=1S/C10H21F3O3Si/c1-4-14-17(15-5-2,16-6-3)9-7-8-10(11,12)13/h4-9H2,1-3H3 |
| InChIKey | JPJHVUMLXYEZJT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethoxy(4,4,4-trifluorobutyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxy(4,4,4-trifluorobutyl)silane?
The IUPAC name of triethoxy(4,4,4-trifluorobutyl)silane (CID 22459507) is triethoxy(4,4,4-trifluorobutyl)silane.
What is the SMILES notation for triethoxy(4,4,4-trifluorobutyl)silane?
The canonical SMILES for triethoxy(4,4,4-trifluorobutyl)silane is CCO[Si](CCCC(F)(F)F)(OCC)OCC.
What is the InChIKey of triethoxy(4,4,4-trifluorobutyl)silane?
The InChIKey is JPJHVUMLXYEZJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F3O3Si/c1-4-14-17(15-5-2,16-6-3)9-7-8-10(11,12)13/h4-9H2,1-3H3.
What are the key properties of triethoxy(4,4,4-trifluorobutyl)silane?
triethoxy(4,4,4-trifluorobutyl)silane has a molecular weight of 274.35 g/mol, XLogP of 3.38, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxy(4,4,4-trifluorobutyl)silane is sourced from PubChem (CID 22459507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).