About 2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol
2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol (PubChem CID 2245956) has the molecular formula C17H19NO3
and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol.
Molecular Properties
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol |
| PubChem CID | 2245956 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol |
| SMILES | COc1ccc(CC/N=C/c2ccccc2O)cc1OC |
| InChI | InChI=1S/C17H19NO3/c1-20-16-8-7-13(11-17(16)21-2)9-10-18-12-14-5-3-4-6-15(14)19/h3-8,11-12,19H,9-10H2,1-2H3/b18-12+ |
| InChIKey | ASARVGFHKPGWSZ-LDADJPATSA-N |
| XLogP | 3.07 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol?
The IUPAC name of 2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol (CID 2245956) is 2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol.
What is the SMILES notation for 2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol?
The canonical SMILES for 2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol is COc1ccc(CC/N=C/c2ccccc2O)cc1OC.
What is the InChIKey of 2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol?
The InChIKey is ASARVGFHKPGWSZ-LDADJPATSA-N. The full InChI is InChI=1S/C17H19NO3/c1-20-16-8-7-13(11-17(16)21-2)9-10-18-12-14-5-3-4-6-15(14)19/h3-8,11-12,19H,9-10H2,1-2H3/b18-12+.
What are the key properties of 2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol?
2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol has a molecular weight of 285.34 g/mol, XLogP of 3.07, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dimethoxyphenyl)ethyliminomethyl]phenol is sourced from PubChem (CID 2245956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).