About N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine
N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine (PubChem CID 22459693) has the molecular formula C19H15N3O2S
and a molecular weight of 349.42 g/mol. Its IUPAC name is N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine |
| PubChem CID | 22459693 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine |
| SMILES | COc1cc(Nc2cnc(-c3ccccc3)s2)ccc1-c1cnco1 |
| InChI | InChI=1S/C19H15N3O2S/c1-23-16-9-14(7-8-15(16)17-10-20-12-24-17)22-18-11-21-19(25-18)13-5-3-2-4-6-13/h2-12,22H,1H3 |
| InChIKey | GIRIKGXBRIWVOD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine?
The IUPAC name of N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine (CID 22459693) is N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine.
What is the SMILES notation for N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine?
The canonical SMILES for N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine is COc1cc(Nc2cnc(-c3ccccc3)s2)ccc1-c1cnco1.
What is the InChIKey of N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine?
The InChIKey is GIRIKGXBRIWVOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O2S/c1-23-16-9-14(7-8-15(16)17-10-20-12-24-17)22-18-11-21-19(25-18)13-5-3-2-4-6-13/h2-12,22H,1H3.
What are the key properties of N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine?
N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine has a molecular weight of 349.42 g/mol, XLogP of 5.22, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-2-phenyl-1,3-thiazol-5-amine is sourced from PubChem (CID 22459693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).