C24H23N7O3 — CID 22459725
4-[4-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-6-phenyl-1,3,5-triazin-2-yl]piperazine-1-carbaldehyde (PubChem CID 22459725) has the molecular formula C24H23N7O3 and a molecular weight of 457.49 g/mol. Its IUPAC name is 4-[4-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-6-phenyl-1,3,5-triazin-2-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[4-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-6-phenyl-1,3,5-triazin-2-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 22459725 |
| Molecular Formula | C24H23N7O3 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 4-[4-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-6-phenyl-1,3,5-triazin-2-yl]piperazine-1-carbaldehyde |
| SMILES | COc1cc(Nc2nc(-c3ccccc3)nc(N3CCN(C=O)CC3)n2)ccc1-c1cnco1 |
| InChI | InChI=1S/C24H23N7O3/c1-33-20-13-18(7-8-19(20)21-14-25-15-34-21)26-23-27-22(17-5-3-2-4-6-17)28-24(29-23)31-11-9-30(16-32)10-12-31/h2-8,13-16H,9-12H2,1H3,(H,26,27,28,29) |
| InChIKey | AOSJCKDUQGUNSO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 109.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|