About propan-2-yl 3-acetamidobutanoate
propan-2-yl 3-acetamidobutanoate (PubChem CID 22460006) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is propan-2-yl 3-acetamidobutanoate.
Molecular Properties
| Compound Name | propan-2-yl 3-acetamidobutanoate |
| PubChem CID | 22460006 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | propan-2-yl 3-acetamidobutanoate |
| SMILES | CC(=O)NC(C)CC(=O)OC(C)C |
| InChI | InChI=1S/C9H17NO3/c1-6(2)13-9(12)5-7(3)10-8(4)11/h6-7H,5H2,1-4H3,(H,10,11) |
| InChIKey | CQOXDIQLSDCRQJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 3-acetamidobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 3-acetamidobutanoate?
The IUPAC name of propan-2-yl 3-acetamidobutanoate (CID 22460006) is propan-2-yl 3-acetamidobutanoate.
What is the SMILES notation for propan-2-yl 3-acetamidobutanoate?
The canonical SMILES for propan-2-yl 3-acetamidobutanoate is CC(=O)NC(C)CC(=O)OC(C)C.
What is the InChIKey of propan-2-yl 3-acetamidobutanoate?
The InChIKey is CQOXDIQLSDCRQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-6(2)13-9(12)5-7(3)10-8(4)11/h6-7H,5H2,1-4H3,(H,10,11).
What are the key properties of propan-2-yl 3-acetamidobutanoate?
propan-2-yl 3-acetamidobutanoate has a molecular weight of 187.24 g/mol, XLogP of 0.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-acetamidobutanoate is sourced from PubChem (CID 22460006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).