C16H24O14 — CID 22460250
1,4,7,10,13,16-hexaoxacyclooctadecane-2,2,3,3-tetracarboxylic acid (PubChem CID 22460250) has the molecular formula C16H24O14 and a molecular weight of 440.35 g/mol. Its IUPAC name is 1,4,7,10,13,16-hexaoxacyclooctadecane-2,2,3,3-tetracarboxylic acid.
| Compound Name | 1,4,7,10,13,16-hexaoxacyclooctadecane-2,2,3,3-tetracarboxylic acid |
|---|---|
| PubChem CID | 22460250 |
| Molecular Formula | C16H24O14 |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 1,4,7,10,13,16-hexaoxacyclooctadecane-2,2,3,3-tetracarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)OCCOCCOCCOCCOCCOC1(C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H24O14/c17-11(18)15(12(19)20)16(13(21)22,14(23)24)30-10-8-28-6-4-26-2-1-25-3-5-27-7-9-29-15/h1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | XBWDPHBNMKHQQH-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 204.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|