C4H2F7O3S- — CID 22460364
2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate (PubChem CID 22460364) has the molecular formula C4H2F7O3S- and a molecular weight of 263.11 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 22460364 |
| Molecular Formula | C4H2F7O3S- |
| Molecular Weight | 263.11 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate |
| SMILES | O=S(=O)([O-])CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H3F7O3S/c5-2(6,1-15(12,13)14)3(7,8)4(9,10)11/h1H2,(H,12,13,14)/p-1 |
| InChIKey | PPGCZBADXNYOFW-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.11 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|