C11H18F6N2O4 — CID 22460992
bis(2,2,2-trifluoroacetic acid);1,2,6-trimethylpiperazine (PubChem CID 22460992) has the molecular formula C11H18F6N2O4 and a molecular weight of 356.26 g/mol. Its IUPAC name is bis(2,2,2-trifluoroacetic acid);1,2,6-trimethylpiperazine.
| Compound Name | bis(2,2,2-trifluoroacetic acid);1,2,6-trimethylpiperazine |
|---|---|
| PubChem CID | 22460992 |
| Molecular Formula | C11H18F6N2O4 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | bis(2,2,2-trifluoroacetic acid);1,2,6-trimethylpiperazine |
| SMILES | CC1CNCC(C)N1C.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H16N2.2C2HF3O2/c1-6-4-8-5-7(2)9(6)3;2*3-2(4,5)1(6)7/h6-8H,4-5H2,1-3H3;2*(H,6,7) |
| InChIKey | VZMXSDJHWUWACE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |