C27H38N2O — CID 2246101
2,6-ditert-butyl-4-[3-(3,4-dihydro-2H-quinolin-1-yl)propyliminomethyl]phenol (PubChem CID 2246101) has the molecular formula C27H38N2O and a molecular weight of 406.61 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[3-(3,4-dihydro-2H-quinolin-1-yl)propyliminomethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[3-(3,4-dihydro-2H-quinolin-1-yl)propyliminomethyl]phenol |
|---|---|
| PubChem CID | 2246101 |
| Molecular Formula | C27H38N2O |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | 2,6-ditert-butyl-4-[3-(3,4-dihydro-2H-quinolin-1-yl)propyliminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/CCCN2CCCc3ccccc32)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H38N2O/c1-26(2,3)22-17-20(18-23(25(22)30)27(4,5)6)19-28-14-10-16-29-15-9-12-21-11-7-8-13-24(21)29/h7-8,11,13,17-19,30H,9-10,12,14-16H2,1-6H3/b28-19+ |
| InChIKey | HMLIZHHYAXRSDC-TURZUDJPSA-N |
| XLogP | 6.25 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|