About 4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide
4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide (PubChem CID 22461072) has the molecular formula C21H23N3O2
and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide.
Molecular Properties
| Compound Name | 4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide |
| PubChem CID | 22461072 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide |
| SMILES | CCNc1c(C(=O)N(C)c2ccccc2)c(=O)n(C)c2cccc(C)c12 |
| InChI | InChI=1S/C21H23N3O2/c1-5-22-19-17-14(2)10-9-13-16(17)24(4)21(26)18(19)20(25)23(3)15-11-7-6-8-12-15/h6-13,22H,5H2,1-4H3 |
| InChIKey | JYUJBAVRXWYCHG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide?
The IUPAC name of 4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide (CID 22461072) is 4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide.
What is the SMILES notation for 4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide?
The canonical SMILES for 4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide is CCNc1c(C(=O)N(C)c2ccccc2)c(=O)n(C)c2cccc(C)c12.
What is the InChIKey of 4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide?
The InChIKey is JYUJBAVRXWYCHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O2/c1-5-22-19-17-14(2)10-9-13-16(17)24(4)21(26)18(19)20(25)23(3)15-11-7-6-8-12-15/h6-13,22H,5H2,1-4H3.
What are the key properties of 4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide?
4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide has a molecular weight of 349.43 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylamino)-N,1,5-trimethyl-2-oxo-N-phenylquinoline-3-carboxamide is sourced from PubChem (CID 22461072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).