C15H14Cl2F3N3O6S3 — CID 22461200
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfonyl-3-(2-methyl-1,1,3,3-tetraoxo-1,3-dithiolan-2-yl)pyrazol-5-amine (PubChem CID 22461200) has the molecular formula C15H14Cl2F3N3O6S3 and a molecular weight of 556.39 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfonyl-3-(2-methyl-1,1,3,3-tetraoxo-1,3-dithiolan-2-yl)pyrazol-5-amine.
| Compound Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfonyl-3-(2-methyl-1,1,3,3-tetraoxo-1,3-dithiolan-2-yl)pyrazol-5-amine |
|---|---|
| PubChem CID | 22461200 |
| Molecular Formula | C15H14Cl2F3N3O6S3 |
| Molecular Weight | 556.39 g/mol |
| Exact Mass | 554.94 |
| IUPAC Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-methylsulfonyl-3-(2-methyl-1,1,3,3-tetraoxo-1,3-dithiolan-2-yl)pyrazol-5-amine |
| SMILES | CC1(c2nn(-c3c(Cl)cc(C(F)(F)F)cc3Cl)c(N)c2S(C)(=O)=O)S(=O)(=O)CCS1(=O)=O |
| InChI | InChI=1S/C15H14Cl2F3N3O6S3/c1-14(31(26,27)3-4-32(14,28)29)12-11(30(2,24)25)13(21)23(22-12)10-8(16)5-7(6-9(10)17)15(18,19)20/h5-6H,3-4,21H2,1-2H3 |
| InChIKey | KBCHQHCWKBFRIL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 146.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |