About 1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol
1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol (PubChem CID 22461333) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol |
| PubChem CID | 22461333 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol |
| SMILES | C=CCC1=CC(OC)C(O)(OC)C=C1 |
| InChI | InChI=1S/C11H16O3/c1-4-5-9-6-7-11(12,14-3)10(8-9)13-2/h4,6-8,10,12H,1,5H2,2-3H3 |
| InChIKey | RFRRZTJURVDMNN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol?
The IUPAC name of 1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol (CID 22461333) is 1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol?
The canonical SMILES for 1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol is C=CCC1=CC(OC)C(O)(OC)C=C1.
What is the InChIKey of 1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol?
The InChIKey is RFRRZTJURVDMNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-4-5-9-6-7-11(12,14-3)10(8-9)13-2/h4,6-8,10,12H,1,5H2,2-3H3.
What are the key properties of 1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol?
1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol has a molecular weight of 196.25 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethoxy-4-prop-2-enylcyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 22461333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).