C41H46O43 — CID 22461902
2-hydroxy-2-[2-oxo-2-[1,1,1,2,2-pentakis[(3,4-dicarboxy-3-hydroxybutanoyl)oxy]-4-oxopentan-3-yl]oxyethyl]butanedioic acid (PubChem CID 22461902) has the molecular formula C41H46O43 and a molecular weight of 1226.78 g/mol. Its IUPAC name is 2-hydroxy-2-[2-oxo-2-[1,1,1,2,2-pentakis[(3,4-dicarboxy-3-hydroxybutanoyl)oxy]-4-oxopentan-3-yl]oxyethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-oxo-2-[1,1,1,2,2-pentakis[(3,4-dicarboxy-3-hydroxybutanoyl)oxy]-4-oxopentan-3-yl]oxyethyl]butanedioic acid |
|---|---|
| PubChem CID | 22461902 |
| Molecular Formula | C41H46O43 |
| Molecular Weight | 1226.78 g/mol |
| Exact Mass | 1226.14 |
| IUPAC Name | 2-hydroxy-2-[2-oxo-2-[1,1,1,2,2-pentakis[(3,4-dicarboxy-3-hydroxybutanoyl)oxy]-4-oxopentan-3-yl]oxyethyl]butanedioic acid |
| SMILES | CC(=O)C(OC(=O)CC(O)(CC(=O)O)C(=O)O)C(OC(=O)CC(O)(CC(=O)O)C(=O)O)(OC(=O)CC(O)(CC(=O)O)C(=O)O)C(OC(=O)CC(O)(CC(=O)O)C(=O)O)(OC(=O)CC(O)(CC(=O)O)C(=O)O)OC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C41H46O43/c1-14(42)27(79-21(55)8-34(73,28(61)62)2-15(43)44)40(80-22(56)9-35(74,29(63)64)3-16(45)46,81-23(57)10-36(75,30(65)66)4-17(47)48)41(82-24(58)11-37(76,31(67)68)5-18(49)50,83-25(59)12-38(77,32(69)70)6-19(51)52)84-26(60)13-39(78,33(71)72)7-20(53)54/h27,73-78H,2-13H2,1H3,(H,43,44)(H,45,46)(H,47,48)(H,49,50)(H,51,52)(H,53,54)(H,61,62)(H,63,64)(H,65,66)(H,67,68)(H,69,70)(H,71,72) |
| InChIKey | XOLAGSYFXPYRNU-UHFFFAOYSA-N |
| XLogP | -8.36 |
| TPSA | 743.85 Ų |
| H-Bond Donors | 18 |
| H-Bond Acceptors | 31 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1226.78 |
| LogP ≤ 5 | -8.36 |
| H-Bond Donors ≤ 5 | 18 |
| H-Bond Acceptors ≤ 10 | 31 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|