About 2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane
2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane (PubChem CID 22461961) has the molecular formula C16H22F2S2
and a molecular weight of 316.48 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane.
Molecular Properties
| Compound Name | 2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane |
| PubChem CID | 22461961 |
| Molecular Formula | C16H22F2S2 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane |
| SMILES | CCCCCCC1(Cc2cccc(F)c2F)SCCS1 |
| InChI | InChI=1S/C16H22F2S2/c1-2-3-4-5-9-16(19-10-11-20-16)12-13-7-6-8-14(17)15(13)18/h6-8H,2-5,9-12H2,1H3 |
| InChIKey | VNKXGYDWNRRHPD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane?
The IUPAC name of 2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane (CID 22461961) is 2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane.
What is the SMILES notation for 2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane?
The canonical SMILES for 2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane is CCCCCCC1(Cc2cccc(F)c2F)SCCS1.
What is the InChIKey of 2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane?
The InChIKey is VNKXGYDWNRRHPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F2S2/c1-2-3-4-5-9-16(19-10-11-20-16)12-13-7-6-8-14(17)15(13)18/h6-8H,2-5,9-12H2,1H3.
What are the key properties of 2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane?
2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane has a molecular weight of 316.48 g/mol, XLogP of 5.65, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-difluorophenyl)methyl]-2-hexyl-1,3-dithiolane is sourced from PubChem (CID 22461961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).