About 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid
5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid (PubChem CID 22462001) has the molecular formula C19H24O8
and a molecular weight of 380.39 g/mol. Its IUPAC name is 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid |
| PubChem CID | 22462001 |
| Molecular Formula | C19H24O8 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid |
| SMILES | C=C(C)C(=O)OCCOC(=O)C12CC3CC(C(=O)O)(CC(C(=O)O)(C3)C1)C2 |
| InChI | InChI=1S/C19H24O8/c1-11(2)13(20)26-3-4-27-16(25)19-7-12-5-17(9-19,14(21)22)8-18(6-12,10-19)15(23)24/h12H,1,3-10H2,2H3,(H,21,22)(H,23,24) |
| InChIKey | VYXZKZYJOCZBJZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid?
The IUPAC name of 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid (CID 22462001) is 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid.
What is the SMILES notation for 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid?
The canonical SMILES for 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid is C=C(C)C(=O)OCCOC(=O)C12CC3CC(C(=O)O)(CC(C(=O)O)(C3)C1)C2.
What is the InChIKey of 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid?
The InChIKey is VYXZKZYJOCZBJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O8/c1-11(2)13(20)26-3-4-27-16(25)19-7-12-5-17(9-19,14(21)22)8-18(6-12,10-19)15(23)24/h12H,1,3-10H2,2H3,(H,21,22)(H,23,24).
What are the key properties of 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid?
5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid has a molecular weight of 380.39 g/mol, XLogP of 1.77, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3-dicarboxylic acid is sourced from PubChem (CID 22462001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).