C20H24O10 — CID 22462022
7-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3,5-tricarboxylic acid (PubChem CID 22462022) has the molecular formula C20H24O10 and a molecular weight of 424.40 g/mol. Its IUPAC name is 7-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3,5-tricarboxylic acid.
| Compound Name | 7-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3,5-tricarboxylic acid |
|---|---|
| PubChem CID | 22462022 |
| Molecular Formula | C20H24O10 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 7-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]adamantane-1,3,5-tricarboxylic acid |
| SMILES | C=C(C)C(=O)OCCOC(=O)C12CC3(C(=O)O)CC(C(=O)O)(CC(C(=O)O)(C3)C1)C2 |
| InChI | InChI=1S/C20H24O10/c1-11(2)12(21)29-3-4-30-16(28)20-8-17(13(22)23)5-18(9-20,14(24)25)7-19(6-17,10-20)15(26)27/h1,3-10H2,2H3,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | BOUGOAKDARBRQB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|