About 2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol
2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol (PubChem CID 22462856) has the molecular formula C12H16F2O5S2
and a molecular weight of 342.39 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol.
Molecular Properties
| Compound Name | 2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol |
| PubChem CID | 22462856 |
| Molecular Formula | C12H16F2O5S2 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol |
| SMILES | CC(C(O)(CS(C)(=O)=O)c1cc(F)ccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C12H16F2O5S2/c1-8(21(3,18)19)12(15,7-20(2,16)17)10-6-9(13)4-5-11(10)14/h4-6,8,15H,7H2,1-3H3 |
| InChIKey | ZBEQDMZUVSSNOL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol?
The IUPAC name of 2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol (CID 22462856) is 2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol.
What is the SMILES notation for 2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol?
The canonical SMILES for 2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol is CC(C(O)(CS(C)(=O)=O)c1cc(F)ccc1F)S(C)(=O)=O.
What is the InChIKey of 2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol?
The InChIKey is ZBEQDMZUVSSNOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2O5S2/c1-8(21(3,18)19)12(15,7-20(2,16)17)10-6-9(13)4-5-11(10)14/h4-6,8,15H,7H2,1-3H3.
What are the key properties of 2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol?
2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol has a molecular weight of 342.39 g/mol, XLogP of 0.63, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-difluorophenyl)-1,3-bis(methylsulfonyl)butan-2-ol is sourced from PubChem (CID 22462856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).