C28H30O13 — CID 22463010
5-[3,4-dicarboxy-4-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-1,5-dien-1-yl]oxy-1-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 22463010) has the molecular formula C28H30O13 and a molecular weight of 574.54 g/mol. Its IUPAC name is 5-[3,4-dicarboxy-4-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-1,5-dien-1-yl]oxy-1-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 5-[3,4-dicarboxy-4-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-1,5-dien-1-yl]oxy-1-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 22463010 |
| Molecular Formula | C28H30O13 |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 5-[3,4-dicarboxy-4-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-1,5-dien-1-yl]oxy-1-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | C=C(C)C(=O)OC(C)C1(C(=O)O)C=CC(OC2=CC(C(=O)O)(C(C)OC(=O)C(=C)C)C(C(=O)O)C=C2)=CC1C(=O)O |
| InChI | InChI=1S/C28H30O13/c1-13(2)23(33)39-15(5)27(25(35)36)10-9-17(11-20(27)22(31)32)41-18-7-8-19(21(29)30)28(12-18,26(37)38)16(6)40-24(34)14(3)4/h7-12,15-16,19-20H,1,3H2,2,4-6H3,(H,29,30)(H,31,32)(H,35,36)(H,37,38) |
| InChIKey | LXUNRYUFIQLSQU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 211.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|