C20H19F3N2O2S — CID 22463280
N-[3-[4-hydroxy-3-[5-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazol-2-yl]phenyl]propyl]prop-2-enamide (PubChem CID 22463280) has the molecular formula C20H19F3N2O2S and a molecular weight of 408.45 g/mol. Its IUPAC name is N-[3-[4-hydroxy-3-[5-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazol-2-yl]phenyl]propyl]prop-2-enamide.
| Compound Name | N-[3-[4-hydroxy-3-[5-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazol-2-yl]phenyl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 22463280 |
| Molecular Formula | C20H19F3N2O2S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-[3-[4-hydroxy-3-[5-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazol-2-yl]phenyl]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCc1ccc(O)c(C2Nc3cc(C(F)(F)F)ccc3S2)c1 |
| InChI | InChI=1S/C20H19F3N2O2S/c1-2-18(27)24-9-3-4-12-5-7-16(26)14(10-12)19-25-15-11-13(20(21,22)23)6-8-17(15)28-19/h2,5-8,10-11,19,25-26H,1,3-4,9H2,(H,24,27) |
| InChIKey | KCGXQDVZSBPCKE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|