C19H24O3S — CID 22463404
9-(benzenesulfonylmethyl)-1,3,3a,4,6,7,8,8a,9,9a-decahydrobenzo[f][2]benzofuran (PubChem CID 22463404) has the molecular formula C19H24O3S and a molecular weight of 332.46 g/mol. Its IUPAC name is 9-(benzenesulfonylmethyl)-1,3,3a,4,6,7,8,8a,9,9a-decahydrobenzo[f][2]benzofuran.
| Compound Name | 9-(benzenesulfonylmethyl)-1,3,3a,4,6,7,8,8a,9,9a-decahydrobenzo[f][2]benzofuran |
|---|---|
| PubChem CID | 22463404 |
| Molecular Formula | C19H24O3S |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 9-(benzenesulfonylmethyl)-1,3,3a,4,6,7,8,8a,9,9a-decahydrobenzo[f][2]benzofuran |
| SMILES | O=S(=O)(CC1C2CCCC=C2CC2COCC21)c1ccccc1 |
| InChI | InChI=1S/C19H24O3S/c20-23(21,16-7-2-1-3-8-16)13-19-17-9-5-4-6-14(17)10-15-11-22-12-18(15)19/h1-3,6-8,15,17-19H,4-5,9-13H2 |
| InChIKey | VWNKVFIUTFCGRB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|