About 3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile
3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile (PubChem CID 22463469) has the molecular formula C8H4F2N2
and a molecular weight of 166.13 g/mol. Its IUPAC name is 3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile.
Molecular Properties
| Compound Name | 3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile |
| PubChem CID | 22463469 |
| Molecular Formula | C8H4F2N2 |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile |
| SMILES | N#CC1=CC(F)C(F)(C#N)C=C1 |
| InChI | InChI=1S/C8H4F2N2/c9-7-3-6(4-11)1-2-8(7,10)5-12/h1-3,7H |
| InChIKey | JUAAOZBJVYUBSX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.13 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile?
The IUPAC name of 3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile (CID 22463469) is 3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile.
What is the SMILES notation for 3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile?
The canonical SMILES for 3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile is N#CC1=CC(F)C(F)(C#N)C=C1.
What is the InChIKey of 3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile?
The InChIKey is JUAAOZBJVYUBSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F2N2/c9-7-3-6(4-11)1-2-8(7,10)5-12/h1-3,7H.
What are the key properties of 3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile?
3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile has a molecular weight of 166.13 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-difluorocyclohexa-1,5-diene-1,4-dicarbonitrile is sourced from PubChem (CID 22463469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).