About cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium
cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium (PubChem CID 2246355) has the molecular formula C25H42NO3+
and a molecular weight of 404.62 g/mol. Its IUPAC name is cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium.
Molecular Properties
| Compound Name | cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium |
| PubChem CID | 2246355 |
| Molecular Formula | C25H42NO3+ |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium |
| SMILES | CC(C)(C)c1cc(CCCOC(=O)C[NH2+]C2CCCCC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H41NO3/c1-24(2,3)20-15-18(16-21(23(20)28)25(4,5)6)11-10-14-29-22(27)17-26-19-12-8-7-9-13-19/h15-16,19,26,28H,7-14,17H2,1-6H3/p+1 |
| InChIKey | HBSXVCGCAQXIRF-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 63.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium?
The IUPAC name of cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium (CID 2246355) is cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium.
What is the SMILES notation for cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium?
The canonical SMILES for cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium is CC(C)(C)c1cc(CCCOC(=O)C[NH2+]C2CCCCC2)cc(C(C)(C)C)c1O.
What is the InChIKey of cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium?
The InChIKey is HBSXVCGCAQXIRF-UHFFFAOYSA-O. The full InChI is InChI=1S/C25H41NO3/c1-24(2,3)20-15-18(16-21(23(20)28)25(4,5)6)11-10-14-29-22(27)17-26-19-12-8-7-9-13-19/h15-16,19,26,28H,7-14,17H2,1-6H3/p+1.
What are the key properties of cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium?
cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium has a molecular weight of 404.62 g/mol, XLogP of 4.36, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-2-oxoethyl]azanium is sourced from PubChem (CID 2246355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).