About 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate
3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate (PubChem CID 2246356) has the molecular formula C25H41NO3
and a molecular weight of 403.61 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate.
Molecular Properties
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate |
| PubChem CID | 2246356 |
| Molecular Formula | C25H41NO3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate |
| SMILES | CC(C)(C)c1cc(CCCOC(=O)CNC2CCCCC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H41NO3/c1-24(2,3)20-15-18(16-21(23(20)28)25(4,5)6)11-10-14-29-22(27)17-26-19-12-8-7-9-13-19/h15-16,19,26,28H,7-14,17H2,1-6H3 |
| InChIKey | HBSXVCGCAQXIRF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate?
The IUPAC name of 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate (CID 2246356) is 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate.
What is the SMILES notation for 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate?
The canonical SMILES for 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate is CC(C)(C)c1cc(CCCOC(=O)CNC2CCCCC2)cc(C(C)(C)C)c1O.
What is the InChIKey of 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate?
The InChIKey is HBSXVCGCAQXIRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H41NO3/c1-24(2,3)20-15-18(16-21(23(20)28)25(4,5)6)11-10-14-29-22(27)17-26-19-12-8-7-9-13-19/h15-16,19,26,28H,7-14,17H2,1-6H3.
What are the key properties of 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate?
3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate has a molecular weight of 403.61 g/mol, XLogP of 5.39, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 2-(cyclohexylamino)acetate is sourced from PubChem (CID 2246356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).