About N'-methylpropanimidamide
N'-methylpropanimidamide (PubChem CID 22463764) has the molecular formula C4H10N2
and a molecular weight of 86.14 g/mol. Its IUPAC name is N'-methylpropanimidamide.
Molecular Properties
| Compound Name | N'-methylpropanimidamide |
| PubChem CID | 22463764 |
| Molecular Formula | C4H10N2 |
| Molecular Weight | 86.14 g/mol |
| Exact Mass | 86.08 |
| IUPAC Name | N'-methylpropanimidamide |
| SMILES | CC/C(N)=N\C |
| InChI | InChI=1S/C4H10N2/c1-3-4(5)6-2/h3H2,1-2H3,(H2,5,6) |
| InChIKey | SVKQJKDFMLYPSM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.14 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-methylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methylpropanimidamide?
The IUPAC name of N'-methylpropanimidamide (CID 22463764) is N'-methylpropanimidamide.
What is the SMILES notation for N'-methylpropanimidamide?
The canonical SMILES for N'-methylpropanimidamide is CC/C(N)=N\C.
What is the InChIKey of N'-methylpropanimidamide?
The InChIKey is SVKQJKDFMLYPSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2/c1-3-4(5)6-2/h3H2,1-2H3,(H2,5,6).
What are the key properties of N'-methylpropanimidamide?
N'-methylpropanimidamide has a molecular weight of 86.14 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methylpropanimidamide is sourced from PubChem (CID 22463764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).