C36H19N5O2 — CID 22463782
7,9-bis(1H-benzimidazol-2-yl)-4-azahexacyclo[10.9.1.113,17.02,6.08,22.021,23]tricosa-1,6,8,10,12(22),13,15,17(23),18,20-decaene-3,5-dione (PubChem CID 22463782) has the molecular formula C36H19N5O2 and a molecular weight of 553.58 g/mol. Its IUPAC name is 7,9-bis(1H-benzimidazol-2-yl)-4-azahexacyclo[10.9.1.113,17.02,6.08,22.021,23]tricosa-1,6,8,10,12(22),13,15,17(23),18,20-decaene-3,5-dione.
| Compound Name | 7,9-bis(1H-benzimidazol-2-yl)-4-azahexacyclo[10.9.1.113,17.02,6.08,22.021,23]tricosa-1,6,8,10,12(22),13,15,17(23),18,20-decaene-3,5-dione |
|---|---|
| PubChem CID | 22463782 |
| Molecular Formula | C36H19N5O2 |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 7,9-bis(1H-benzimidazol-2-yl)-4-azahexacyclo[10.9.1.113,17.02,6.08,22.021,23]tricosa-1,6,8,10,12(22),13,15,17(23),18,20-decaene-3,5-dione |
| SMILES | O=c1[nH]c(=O)c2c1c(-c1nc3ccccc3[nH]1)c1c(-c3nc4ccccc4[nH]3)ccc3c4cccc5cccc(c54)c2c13 |
| InChI | InChI=1S/C36H19N5O2/c42-35-31-28-20-10-6-8-17-7-5-9-18(26(17)20)19-15-16-21(33-37-22-11-1-2-12-23(22)38-33)29(27(19)28)30(32(31)36(43)41-35)34-39-24-13-3-4-14-25(24)40-34/h1-16H,(H,37,38)(H,39,40)(H,41,42,43) |
| InChIKey | JJXSHPFRKKJOSE-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|