About 2-phenylethyl N,N-diethylcarbamodithioate
2-phenylethyl N,N-diethylcarbamodithioate (PubChem CID 22463827) has the molecular formula C13H19NS2
and a molecular weight of 253.44 g/mol. Its IUPAC name is 2-phenylethyl N,N-diethylcarbamodithioate.
Molecular Properties
| Compound Name | 2-phenylethyl N,N-diethylcarbamodithioate |
| PubChem CID | 22463827 |
| Molecular Formula | C13H19NS2 |
| Molecular Weight | 253.44 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-phenylethyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCCc1ccccc1 |
| InChI | InChI=1S/C13H19NS2/c1-3-14(4-2)13(15)16-11-10-12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3 |
| InChIKey | AXLIUHFWGFTOER-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethyl N,N-diethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl N,N-diethylcarbamodithioate?
The IUPAC name of 2-phenylethyl N,N-diethylcarbamodithioate (CID 22463827) is 2-phenylethyl N,N-diethylcarbamodithioate.
What is the SMILES notation for 2-phenylethyl N,N-diethylcarbamodithioate?
The canonical SMILES for 2-phenylethyl N,N-diethylcarbamodithioate is CCN(CC)C(=S)SCCc1ccccc1.
What is the InChIKey of 2-phenylethyl N,N-diethylcarbamodithioate?
The InChIKey is AXLIUHFWGFTOER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NS2/c1-3-14(4-2)13(15)16-11-10-12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3.
What are the key properties of 2-phenylethyl N,N-diethylcarbamodithioate?
2-phenylethyl N,N-diethylcarbamodithioate has a molecular weight of 253.44 g/mol, XLogP of 3.59, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl N,N-diethylcarbamodithioate is sourced from PubChem (CID 22463827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).