About 1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide
1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide (PubChem CID 22463940) has the molecular formula C18H19NO2S
and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide.
Molecular Properties
| Compound Name | 1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide |
| PubChem CID | 22463940 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide |
| SMILES | CN1CCC2(CC1)c1ccccc1S(=O)(=O)c1ccccc12 |
| InChI | InChI=1S/C18H19NO2S/c1-19-12-10-18(11-13-19)14-6-2-4-8-16(14)22(20,21)17-9-5-3-7-15(17)18/h2-9H,10-13H2,1H3 |
| InChIKey | UNWZEKUABATFRD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide?
The IUPAC name of 1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide (CID 22463940) is 1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide.
What is the SMILES notation for 1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide?
The canonical SMILES for 1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide is CN1CCC2(CC1)c1ccccc1S(=O)(=O)c1ccccc12.
What is the InChIKey of 1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide?
The InChIKey is UNWZEKUABATFRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO2S/c1-19-12-10-18(11-13-19)14-6-2-4-8-16(14)22(20,21)17-9-5-3-7-15(17)18/h2-9H,10-13H2,1H3.
What are the key properties of 1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide?
1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide has a molecular weight of 313.42 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylspiro[piperidine-4,9'-thioxanthene] 10',10'-dioxide is sourced from PubChem (CID 22463940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).