C12H13ClF2O2 — CID 22464438
4-(chloromethyl)-4-(2,4-difluorophenyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 22464438) has the molecular formula C12H13ClF2O2 and a molecular weight of 262.68 g/mol. Its IUPAC name is 4-(chloromethyl)-4-(2,4-difluorophenyl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-(chloromethyl)-4-(2,4-difluorophenyl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 22464438 |
| Molecular Formula | C12H13ClF2O2 |
| Molecular Weight | 262.68 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 4-(chloromethyl)-4-(2,4-difluorophenyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(CCl)(c2ccc(F)cc2F)O1 |
| InChI | InChI=1S/C12H13ClF2O2/c1-11(2)16-7-12(6-13,17-11)9-4-3-8(14)5-10(9)15/h3-5H,6-7H2,1-2H3 |
| InChIKey | VSJJDTDSMPEGDU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|