About 3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide
3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide (PubChem CID 22464468) has the molecular formula C11H12F3NOS
and a molecular weight of 263.28 g/mol. Its IUPAC name is 3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide.
Molecular Properties
| Compound Name | 3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide |
| PubChem CID | 22464468 |
| Molecular Formula | C11H12F3NOS |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide |
| SMILES | CCSc1ccccc1CC(F)(F)C(=O)NF |
| InChI | InChI=1S/C11H12F3NOS/c1-2-17-9-6-4-3-5-8(9)7-11(12,13)10(16)15-14/h3-6H,2,7H2,1H3,(H,15,16) |
| InChIKey | ZTPYCIUDHKRIJI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide?
The IUPAC name of 3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide (CID 22464468) is 3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide.
What is the SMILES notation for 3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide?
The canonical SMILES for 3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide is CCSc1ccccc1CC(F)(F)C(=O)NF.
What is the InChIKey of 3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide?
The InChIKey is ZTPYCIUDHKRIJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3NOS/c1-2-17-9-6-4-3-5-8(9)7-11(12,13)10(16)15-14/h3-6H,2,7H2,1H3,(H,15,16).
What are the key properties of 3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide?
3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide has a molecular weight of 263.28 g/mol, XLogP of 2.98, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethylsulfanylphenyl)-N,2,2-trifluoropropanamide is sourced from PubChem (CID 22464468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).