C13H12ClF2N5O3 — CID 22464519
2-[6-chloro-3-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-2-oxopyrazin-1-yl]acetamide (PubChem CID 22464519) has the molecular formula C13H12ClF2N5O3 and a molecular weight of 359.72 g/mol. Its IUPAC name is 2-[6-chloro-3-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-2-oxopyrazin-1-yl]acetamide.
| Compound Name | 2-[6-chloro-3-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-2-oxopyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 22464519 |
| Molecular Formula | C13H12ClF2N5O3 |
| Molecular Weight | 359.72 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 2-[6-chloro-3-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-2-oxopyrazin-1-yl]acetamide |
| SMILES | NC(=O)Cn1c(Cl)cnc(NCC(F)(F)c2cccc[n+]2[O-])c1=O |
| InChI | InChI=1S/C13H12ClF2N5O3/c14-9-5-18-11(12(23)20(9)6-10(17)22)19-7-13(15,16)8-3-1-2-4-21(8)24/h1-5H,6-7H2,(H2,17,22)(H,18,19) |
| InChIKey | KFNHBVKFTZPGQO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.72 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|