C24H32N6OS — CID 22464839
4-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-imine (PubChem CID 22464839) has the molecular formula C24H32N6OS and a molecular weight of 452.63 g/mol. Its IUPAC name is 4-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-imine.
| Compound Name | 4-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-imine |
|---|---|
| PubChem CID | 22464839 |
| Molecular Formula | C24H32N6OS |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 4-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-imine |
| SMILES | [H]/N=c1/c2c3c(sc2ncn1CCCN1CCN(c2cccc(OC)c2)CC1)CN(C)CC3 |
| InChI | InChI=1S/C24H32N6OS/c1-27-10-7-20-21(16-27)32-24-22(20)23(25)30(17-26-24)9-4-8-28-11-13-29(14-12-28)18-5-3-6-19(15-18)31-2/h3,5-6,15,17,25H,4,7-14,16H2,1-2H3/b25-23- |
| InChIKey | ULGDLBVLBJPUIQ-BZZOAKBMSA-N |
| XLogP | 2.79 |
| TPSA | 60.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |