C24H40Fe — CID 22465099
iron;bis(1,2,3,5-tetramethyl-4-propylcyclopenta-1,3-diene) (PubChem CID 22465099) has the molecular formula C24H40Fe and a molecular weight of 384.43 g/mol. Its IUPAC name is iron;bis(1,2,3,5-tetramethyl-4-propylcyclopenta-1,3-diene).
| Compound Name | iron;bis(1,2,3,5-tetramethyl-4-propylcyclopenta-1,3-diene) |
|---|---|
| PubChem CID | 22465099 |
| Molecular Formula | C24H40Fe |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | iron;bis(1,2,3,5-tetramethyl-4-propylcyclopenta-1,3-diene) |
| SMILES | CCCC1=C(C)C(C)=C(C)C1C.CCCC1=C(C)C(C)=C(C)C1C.[Fe] |
| InChI | InChI=1S/2C12H20.Fe/c2*1-6-7-12-10(4)8(2)9(3)11(12)5;/h2*10H,6-7H2,1-5H3; |
| InChIKey | ZYKROOPYHBVZPU-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|