About 1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene
1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene (PubChem CID 22465558) has the molecular formula C25H28
and a molecular weight of 328.50 g/mol. Its IUPAC name is 1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene.
Molecular Properties
| Compound Name | 1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene |
| PubChem CID | 22465558 |
| Molecular Formula | C25H28 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene |
| SMILES | Cc1ccc(C)c2c1C=CC2C(C)(C)C1C=Cc2c(C)ccc(C)c21 |
| InChI | InChI=1S/C25H28/c1-15-7-9-17(3)23-19(15)11-13-21(23)25(5,6)22-14-12-20-16(2)8-10-18(4)24(20)22/h7-14,21-22H,1-6H3 |
| InChIKey | UWCMLYUYEOPBQP-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene?
The IUPAC name of 1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene (CID 22465558) is 1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene.
What is the SMILES notation for 1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene?
The canonical SMILES for 1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene is Cc1ccc(C)c2c1C=CC2C(C)(C)C1C=Cc2c(C)ccc(C)c21.
What is the InChIKey of 1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene?
The InChIKey is UWCMLYUYEOPBQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28/c1-15-7-9-17(3)23-19(15)11-13-21(23)25(5,6)22-14-12-20-16(2)8-10-18(4)24(20)22/h7-14,21-22H,1-6H3.
What are the key properties of 1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene?
1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene has a molecular weight of 328.50 g/mol, XLogP of 6.87, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4,7-dimethyl-1H-inden-1-yl)propan-2-yl]-4,7-dimethyl-1H-indene is sourced from PubChem (CID 22465558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).