About 6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one
6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one (PubChem CID 22465822) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one |
| PubChem CID | 22465822 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one |
| SMILES | CC1=CC=C(C)C(N)C1=O |
| InChI | InChI=1S/C8H11NO/c1-5-3-4-6(2)8(10)7(5)9/h3-4,7H,9H2,1-2H3 |
| InChIKey | OXOUOELNJDWKDL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one?
The IUPAC name of 6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one (CID 22465822) is 6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one is CC1=CC=C(C)C(N)C1=O.
What is the InChIKey of 6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one?
The InChIKey is OXOUOELNJDWKDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c1-5-3-4-6(2)8(10)7(5)9/h3-4,7H,9H2,1-2H3.
What are the key properties of 6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one?
6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one has a molecular weight of 137.18 g/mol, XLogP of 0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2,5-dimethylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 22465822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).