About 3,5-dimethylmorpholine;ethene
3,5-dimethylmorpholine;ethene (PubChem CID 22465833) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 3,5-dimethylmorpholine;ethene.
Molecular Properties
| Compound Name | 3,5-dimethylmorpholine;ethene |
| PubChem CID | 22465833 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 3,5-dimethylmorpholine;ethene |
| SMILES | C=C.CC1COCC(C)N1 |
| InChI | InChI=1S/C6H13NO.C2H4/c1-5-3-8-4-6(2)7-5;1-2/h5-7H,3-4H2,1-2H3;1-2H2 |
| InChIKey | WDTSIKLZDWNUMI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethylmorpholine;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethylmorpholine;ethene?
The IUPAC name of 3,5-dimethylmorpholine;ethene (CID 22465833) is 3,5-dimethylmorpholine;ethene.
What is the SMILES notation for 3,5-dimethylmorpholine;ethene?
The canonical SMILES for 3,5-dimethylmorpholine;ethene is C=C.CC1COCC(C)N1.
What is the InChIKey of 3,5-dimethylmorpholine;ethene?
The InChIKey is WDTSIKLZDWNUMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C2H4/c1-5-3-8-4-6(2)7-5;1-2/h5-7H,3-4H2,1-2H3;1-2H2.
What are the key properties of 3,5-dimethylmorpholine;ethene?
3,5-dimethylmorpholine;ethene has a molecular weight of 143.23 g/mol, XLogP of 1.19, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylmorpholine;ethene is sourced from PubChem (CID 22465833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).