C10H9F8N3O — CID 2246718
4-methyl-6-(2,2,3,3,4,4,5,5-octafluoropentoxy)pyrimidin-2-amine (PubChem CID 2246718) has the molecular formula C10H9F8N3O and a molecular weight of 339.19 g/mol. Its IUPAC name is 4-methyl-6-(2,2,3,3,4,4,5,5-octafluoropentoxy)pyrimidin-2-amine.
| Compound Name | 4-methyl-6-(2,2,3,3,4,4,5,5-octafluoropentoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 2246718 |
| Molecular Formula | C10H9F8N3O |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 4-methyl-6-(2,2,3,3,4,4,5,5-octafluoropentoxy)pyrimidin-2-amine |
| SMILES | Cc1cc(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)nc(N)n1 |
| InChI | InChI=1S/C10H9F8N3O/c1-4-2-5(21-7(19)20-4)22-3-8(13,14)10(17,18)9(15,16)6(11)12/h2,6H,3H2,1H3,(H2,19,20,21) |
| InChIKey | PYLQFLPNCXPNNY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|