About 2-ethenylimidazole-1,4-dicarbonitrile
2-ethenylimidazole-1,4-dicarbonitrile (PubChem CID 22467198) has the molecular formula C7H4N4
and a molecular weight of 144.14 g/mol. Its IUPAC name is 2-ethenylimidazole-1,4-dicarbonitrile.
Molecular Properties
| Compound Name | 2-ethenylimidazole-1,4-dicarbonitrile |
| PubChem CID | 22467198 |
| Molecular Formula | C7H4N4 |
| Molecular Weight | 144.14 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 2-ethenylimidazole-1,4-dicarbonitrile |
| SMILES | C=Cc1nc(C#N)cn1C#N |
| InChI | InChI=1S/C7H4N4/c1-2-7-10-6(3-8)4-11(7)5-9/h2,4H,1H2 |
| InChIKey | ZAOVLZFLNGFEFZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.14 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethenylimidazole-1,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylimidazole-1,4-dicarbonitrile?
The IUPAC name of 2-ethenylimidazole-1,4-dicarbonitrile (CID 22467198) is 2-ethenylimidazole-1,4-dicarbonitrile.
What is the SMILES notation for 2-ethenylimidazole-1,4-dicarbonitrile?
The canonical SMILES for 2-ethenylimidazole-1,4-dicarbonitrile is C=Cc1nc(C#N)cn1C#N.
What is the InChIKey of 2-ethenylimidazole-1,4-dicarbonitrile?
The InChIKey is ZAOVLZFLNGFEFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N4/c1-2-7-10-6(3-8)4-11(7)5-9/h2,4H,1H2.
What are the key properties of 2-ethenylimidazole-1,4-dicarbonitrile?
2-ethenylimidazole-1,4-dicarbonitrile has a molecular weight of 144.14 g/mol, XLogP of 0.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylimidazole-1,4-dicarbonitrile is sourced from PubChem (CID 22467198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).