C10H3Br2ClF8O4S — CID 22467807
2,4-bis(2-bromo-1,1,2,2-tetrafluoroethoxy)benzenesulfonyl chloride (PubChem CID 22467807) has the molecular formula C10H3Br2ClF8O4S and a molecular weight of 566.44 g/mol. Its IUPAC name is 2,4-bis(2-bromo-1,1,2,2-tetrafluoroethoxy)benzenesulfonyl chloride.
| Compound Name | 2,4-bis(2-bromo-1,1,2,2-tetrafluoroethoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 22467807 |
| Molecular Formula | C10H3Br2ClF8O4S |
| Molecular Weight | 566.44 g/mol |
| Exact Mass | 563.77 |
| IUPAC Name | 2,4-bis(2-bromo-1,1,2,2-tetrafluoroethoxy)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(OC(F)(F)C(F)(F)Br)cc1OC(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C10H3Br2ClF8O4S/c11-7(14,15)9(18,19)24-4-1-2-6(26(13,22)23)5(3-4)25-10(20,21)8(12,16)17/h1-3H |
| InChIKey | YMNPQUYDHSINRN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|