About 4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline
4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline (PubChem CID 2246796) has the molecular formula C27H26N2
and a molecular weight of 378.52 g/mol. Its IUPAC name is 4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline.
Molecular Properties
| Compound Name | 4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline |
| PubChem CID | 2246796 |
| Molecular Formula | C27H26N2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H26N2/c1-3-29(4-2)25-17-15-21(16-18-25)24-19-26(22-11-7-5-8-12-22)28-27(20-24)23-13-9-6-10-14-23/h5-20H,3-4H2,1-2H3 |
| InChIKey | RIZMXDDYOKBBEZ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline?
The IUPAC name of 4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline (CID 2246796) is 4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline.
What is the SMILES notation for 4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline?
The canonical SMILES for 4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline is CCN(CC)c1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1.
What is the InChIKey of 4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline?
The InChIKey is RIZMXDDYOKBBEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N2/c1-3-29(4-2)25-17-15-21(16-18-25)24-19-26(22-11-7-5-8-12-22)28-27(20-24)23-13-9-6-10-14-23/h5-20H,3-4H2,1-2H3.
What are the key properties of 4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline?
4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline has a molecular weight of 378.52 g/mol, XLogP of 6.93, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-diphenyl-4-pyridinyl)-N,N-diethylaniline is sourced from PubChem (CID 2246796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).