C32H40F2N4O5 — CID 22468444
1-[2-(3,5-difluorophenoxy)ethyl]-N-hydroxy-4-[3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]piperidine-4-carboxamide (PubChem CID 22468444) has the molecular formula C32H40F2N4O5 and a molecular weight of 598.69 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenoxy)ethyl]-N-hydroxy-4-[3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(3,5-difluorophenoxy)ethyl]-N-hydroxy-4-[3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22468444 |
| Molecular Formula | C32H40F2N4O5 |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | 1-[2-(3,5-difluorophenoxy)ethyl]-N-hydroxy-4-[3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CN3CCOCC3)c(CCCC3(C(=O)NO)CCN(CCOc4cc(F)cc(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C32H40F2N4O5/c1-41-26-4-5-30-29(20-26)28(23(21-35-30)22-38-11-14-42-15-12-38)3-2-6-32(31(39)36-40)7-9-37(10-8-32)13-16-43-27-18-24(33)17-25(34)19-27/h4-5,17-21,40H,2-3,6-16,22H2,1H3,(H,36,39) |
| InChIKey | PPFFLIVYXBTJMZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 96.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|