About 2,5-dimethyl-2,3-dihydrofuran-3-thiol
2,5-dimethyl-2,3-dihydrofuran-3-thiol (PubChem CID 22472236) has the molecular formula C6H10OS
and a molecular weight of 130.21 g/mol. Its IUPAC name is 2,5-dimethyl-2,3-dihydrofuran-3-thiol.
Molecular Properties
| Compound Name | 2,5-dimethyl-2,3-dihydrofuran-3-thiol |
| PubChem CID | 22472236 |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 2,5-dimethyl-2,3-dihydrofuran-3-thiol |
| SMILES | CC1=CC(S)C(C)O1 |
| InChI | InChI=1S/C6H10OS/c1-4-3-6(8)5(2)7-4/h3,5-6,8H,1-2H3 |
| InChIKey | HUJUNODYULVKGU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-2,3-dihydrofuran-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-2,3-dihydrofuran-3-thiol?
The IUPAC name of 2,5-dimethyl-2,3-dihydrofuran-3-thiol (CID 22472236) is 2,5-dimethyl-2,3-dihydrofuran-3-thiol.
What is the SMILES notation for 2,5-dimethyl-2,3-dihydrofuran-3-thiol?
The canonical SMILES for 2,5-dimethyl-2,3-dihydrofuran-3-thiol is CC1=CC(S)C(C)O1.
What is the InChIKey of 2,5-dimethyl-2,3-dihydrofuran-3-thiol?
The InChIKey is HUJUNODYULVKGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10OS/c1-4-3-6(8)5(2)7-4/h3,5-6,8H,1-2H3.
What are the key properties of 2,5-dimethyl-2,3-dihydrofuran-3-thiol?
2,5-dimethyl-2,3-dihydrofuran-3-thiol has a molecular weight of 130.21 g/mol, XLogP of 1.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-2,3-dihydrofuran-3-thiol is sourced from PubChem (CID 22472236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).