About 1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole
1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole (PubChem CID 22472428) has the molecular formula C46H34N6
and a molecular weight of 670.82 g/mol. Its IUPAC name is 1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole.
Molecular Properties
| Compound Name | 1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole |
| PubChem CID | 22472428 |
| Molecular Formula | C46H34N6 |
| Molecular Weight | 670.82 g/mol |
| Exact Mass | 670.28 |
| IUPAC Name | 1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)n(C(n3nc(-c4ccccc4)cc3-c3ccccc3)n3nc(-c4ccccc4)cc3-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C46H34N6/c1-7-19-34(20-8-1)40-31-43(37-25-13-4-14-26-37)50(47-40)46(51-44(38-27-15-5-16-28-38)32-41(48-51)35-21-9-2-10-22-35)52-45(39-29-17-6-18-30-39)33-42(49-52)36-23-11-3-12-24-36/h1-33,46H |
| InChIKey | FYZQRGHFYMDZFP-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 670.82 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole?
The IUPAC name of 1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole (CID 22472428) is 1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole.
What is the SMILES notation for 1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole?
The canonical SMILES for 1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole is c1ccc(-c2cc(-c3ccccc3)n(C(n3nc(-c4ccccc4)cc3-c3ccccc3)n3nc(-c4ccccc4)cc3-c3ccccc3)n2)cc1.
What is the InChIKey of 1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole?
The InChIKey is FYZQRGHFYMDZFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H34N6/c1-7-19-34(20-8-1)40-31-43(37-25-13-4-14-26-37)50(47-40)46(51-44(38-27-15-5-16-28-38)32-41(48-51)35-21-9-2-10-22-35)52-45(39-29-17-6-18-30-39)33-42(49-52)36-23-11-3-12-24-36/h1-33,46H.
What are the key properties of 1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole?
1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole has a molecular weight of 670.82 g/mol, XLogP of 10.83, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(3,5-diphenylpyrazol-1-yl)methyl]-3,5-diphenylpyrazole is sourced from PubChem (CID 22472428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).