About 3-(4-amino-3,5-dimethylphenyl)propan-1-ol
3-(4-amino-3,5-dimethylphenyl)propan-1-ol (PubChem CID 22472438) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 3-(4-amino-3,5-dimethylphenyl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(4-amino-3,5-dimethylphenyl)propan-1-ol |
| PubChem CID | 22472438 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 3-(4-amino-3,5-dimethylphenyl)propan-1-ol |
| SMILES | Cc1cc(CCCO)cc(C)c1N |
| InChI | InChI=1S/C11H17NO/c1-8-6-10(4-3-5-13)7-9(2)11(8)12/h6-7,13H,3-5,12H2,1-2H3 |
| InChIKey | ZOLHJKXYRQTXFY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-amino-3,5-dimethylphenyl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-amino-3,5-dimethylphenyl)propan-1-ol?
The IUPAC name of 3-(4-amino-3,5-dimethylphenyl)propan-1-ol (CID 22472438) is 3-(4-amino-3,5-dimethylphenyl)propan-1-ol.
What is the SMILES notation for 3-(4-amino-3,5-dimethylphenyl)propan-1-ol?
The canonical SMILES for 3-(4-amino-3,5-dimethylphenyl)propan-1-ol is Cc1cc(CCCO)cc(C)c1N.
What is the InChIKey of 3-(4-amino-3,5-dimethylphenyl)propan-1-ol?
The InChIKey is ZOLHJKXYRQTXFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-8-6-10(4-3-5-13)7-9(2)11(8)12/h6-7,13H,3-5,12H2,1-2H3.
What are the key properties of 3-(4-amino-3,5-dimethylphenyl)propan-1-ol?
3-(4-amino-3,5-dimethylphenyl)propan-1-ol has a molecular weight of 179.26 g/mol, XLogP of 1.81, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-amino-3,5-dimethylphenyl)propan-1-ol is sourced from PubChem (CID 22472438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).