C30H45N3O6 — CID 22473381
4-ethyl-1-methyl-1-oxido-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-ium-2-one;N-hexylformamide (PubChem CID 22473381) has the molecular formula C30H45N3O6 and a molecular weight of 543.71 g/mol. Its IUPAC name is 4-ethyl-1-methyl-1-oxido-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-ium-2-one;N-hexylformamide.
| Compound Name | 4-ethyl-1-methyl-1-oxido-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-ium-2-one;N-hexylformamide |
|---|---|
| PubChem CID | 22473381 |
| Molecular Formula | C30H45N3O6 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | 4-ethyl-1-methyl-1-oxido-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazin-1-ium-2-one;N-hexylformamide |
| SMILES | CCCCCCNC=O.CCN1CC[N+](C)([O-])C(=O)C1Cc1ccc(-c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H30N2O5.C7H15NO/c1-6-24-11-12-25(2,27)23(26)19(24)13-16-7-9-17(10-8-16)18-14-20(28-3)22(30-5)21(15-18)29-4;1-2-3-4-5-6-8-7-9/h7-10,14-15,19H,6,11-13H2,1-5H3;7H,2-6H2,1H3,(H,8,9) |
| InChIKey | YDRACTMUSUECDI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|