C13H24O5 — CID 22473551
3,3-diethoxy-1-(2,2,4-trimethyl-1,3-dioxolan-4-yl)propan-1-one (PubChem CID 22473551) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is 3,3-diethoxy-1-(2,2,4-trimethyl-1,3-dioxolan-4-yl)propan-1-one.
| Compound Name | 3,3-diethoxy-1-(2,2,4-trimethyl-1,3-dioxolan-4-yl)propan-1-one |
|---|---|
| PubChem CID | 22473551 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3,3-diethoxy-1-(2,2,4-trimethyl-1,3-dioxolan-4-yl)propan-1-one |
| SMILES | CCOC(CC(=O)C1(C)COC(C)(C)O1)OCC |
| InChI | InChI=1S/C13H24O5/c1-6-15-11(16-7-2)8-10(14)13(5)9-17-12(3,4)18-13/h11H,6-9H2,1-5H3 |
| InChIKey | DMBPNYQDBJWENC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|