C15H16BFN2O2 — CID 22473577
2-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorophenyl]pyrazine (PubChem CID 22473577) has the molecular formula C15H16BFN2O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is 2-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorophenyl]pyrazine.
| Compound Name | 2-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorophenyl]pyrazine |
|---|---|
| PubChem CID | 22473577 |
| Molecular Formula | C15H16BFN2O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorophenyl]pyrazine |
| SMILES | CC1(C)COB(c2ccc(F)c(-c3cnccn3)c2)OC1 |
| InChI | InChI=1S/C15H16BFN2O2/c1-15(2)9-20-16(21-10-15)11-3-4-13(17)12(7-11)14-8-18-5-6-19-14/h3-8H,9-10H2,1-2H3 |
| InChIKey | BBYXZYIUMNODLO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|